C19H21Cl2N3O5 — CID 68611853
4-aminonaphthalene-1,8-dicarboxylic acid;(3,4-diaminophenyl)methanol;dihydrochloride (PubChem CID 68611853) has the molecular formula C19H21Cl2N3O5 and a molecular weight of 442.30 g/mol. Its IUPAC name is 4-aminonaphthalene-1,8-dicarboxylic acid;(3,4-diaminophenyl)methanol;dihydrochloride.
| Compound Name | 4-aminonaphthalene-1,8-dicarboxylic acid;(3,4-diaminophenyl)methanol;dihydrochloride |
|---|---|
| PubChem CID | 68611853 |
| Molecular Formula | C19H21Cl2N3O5 |
| Molecular Weight | 442.30 g/mol |
| Exact Mass | 441.09 |
| IUPAC Name | 4-aminonaphthalene-1,8-dicarboxylic acid;(3,4-diaminophenyl)methanol;dihydrochloride |
| SMILES | Cl.Cl.Nc1ccc(C(=O)O)c2c(C(=O)O)cccc12.Nc1ccc(CO)cc1N |
| InChI | InChI=1S/C12H9NO4.C7H10N2O.2ClH/c13-9-5-4-8(12(16)17)10-6(9)2-1-3-7(10)11(14)15;8-6-2-1-5(4-10)3-7(6)9;;/h1-5H,13H2,(H,14,15)(H,16,17);1-3,10H,4,8-9H2;2*1H |
| InChIKey | JCXLSVFQUIRNFE-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 172.89 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.30 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|