C19H32O3 — CID 68611964
5,5,7,9-tetramethyl-1-oxacyclohexadec-13-ene-2,6-dione (PubChem CID 68611964) has the molecular formula C19H32O3 and a molecular weight of 308.46 g/mol. Its IUPAC name is 5,5,7,9-tetramethyl-1-oxacyclohexadec-13-ene-2,6-dione.
| Compound Name | 5,5,7,9-tetramethyl-1-oxacyclohexadec-13-ene-2,6-dione |
|---|---|
| PubChem CID | 68611964 |
| Molecular Formula | C19H32O3 |
| Molecular Weight | 308.46 g/mol |
| Exact Mass | 308.24 |
| IUPAC Name | 5,5,7,9-tetramethyl-1-oxacyclohexadec-13-ene-2,6-dione |
| SMILES | CC1CCCC=CCCOC(=O)CCC(C)(C)C(=O)C(C)C1 |
| InChI | InChI=1S/C19H32O3/c1-15-10-8-6-5-7-9-13-22-17(20)11-12-19(3,4)18(21)16(2)14-15/h5,7,15-16H,6,8-14H2,1-4H3 |
| InChIKey | IVMZNDSQACYUTR-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.46 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|