About 3-[[4-[(6-chlorothieno[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl]methyl]-2-methylbenzoic acid
3-[[4-[(6-chlorothieno[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl]methyl]-2-methylbenzoic acid (PubChem CID 68612201) has the molecular formula C20H21ClN4O2S
and a molecular weight of 416.93 g/mol. Its IUPAC name is 3-[[4-[(6-chlorothieno[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl]methyl]-2-methylbenzoic acid.
Molecular Properties
| Compound Name | 3-[[4-[(6-chlorothieno[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl]methyl]-2-methylbenzoic acid |
| PubChem CID | 68612201 |
| Molecular Formula | C20H21ClN4O2S |
| Molecular Weight | 416.93 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | 3-[[4-[(6-chlorothieno[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl]methyl]-2-methylbenzoic acid |
| SMILES | Cc1c(CN2CCC(Nc3ncnc4sc(Cl)cc34)CC2)cccc1C(=O)O |
| InChI | InChI=1S/C20H21ClN4O2S/c1-12-13(3-2-4-15(12)20(26)27)10-25-7-5-14(6-8-25)24-18-16-9-17(21)28-19(16)23-11-22-18/h2-4,9,11,14H,5-8,10H2,1H3,(H,26,27)(H,22,23,24) |
| InChIKey | SAZOSGQUQXLMRU-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.93 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[[4-[(6-chlorothieno[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl]methyl]-2-methylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[4-[(6-chlorothieno[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl]methyl]-2-methylbenzoic acid?
The IUPAC name of 3-[[4-[(6-chlorothieno[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl]methyl]-2-methylbenzoic acid (CID 68612201) is 3-[[4-[(6-chlorothieno[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl]methyl]-2-methylbenzoic acid.
What is the SMILES notation for 3-[[4-[(6-chlorothieno[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl]methyl]-2-methylbenzoic acid?
The canonical SMILES for 3-[[4-[(6-chlorothieno[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl]methyl]-2-methylbenzoic acid is Cc1c(CN2CCC(Nc3ncnc4sc(Cl)cc34)CC2)cccc1C(=O)O.
What is the InChIKey of 3-[[4-[(6-chlorothieno[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl]methyl]-2-methylbenzoic acid?
The InChIKey is SAZOSGQUQXLMRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21ClN4O2S/c1-12-13(3-2-4-15(12)20(26)27)10-25-7-5-14(6-8-25)24-18-16-9-17(21)28-19(16)23-11-22-18/h2-4,9,11,14H,5-8,10H2,1H3,(H,26,27)(H,22,23,24).
What are the key properties of 3-[[4-[(6-chlorothieno[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl]methyl]-2-methylbenzoic acid?
3-[[4-[(6-chlorothieno[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl]methyl]-2-methylbenzoic acid has a molecular weight of 416.93 g/mol, XLogP of 4.43, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[4-[(6-chlorothieno[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl]methyl]-2-methylbenzoic acid is sourced from PubChem (CID 68612201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).