C23H20N2O6 — CID 68613148
ethyl 6,8-dimethoxy-1-(3-oxo-1H-isoindole-2-carbonyl)isoquinoline-4-carboxylate (PubChem CID 68613148) has the molecular formula C23H20N2O6 and a molecular weight of 420.42 g/mol. Its IUPAC name is ethyl 6,8-dimethoxy-1-(3-oxo-1H-isoindole-2-carbonyl)isoquinoline-4-carboxylate.
| Compound Name | ethyl 6,8-dimethoxy-1-(3-oxo-1H-isoindole-2-carbonyl)isoquinoline-4-carboxylate |
|---|---|
| PubChem CID | 68613148 |
| Molecular Formula | C23H20N2O6 |
| Molecular Weight | 420.42 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | ethyl 6,8-dimethoxy-1-(3-oxo-1H-isoindole-2-carbonyl)isoquinoline-4-carboxylate |
| SMILES | CCOC(=O)c1cnc(C(=O)N2Cc3ccccc3C2=O)c2c(OC)cc(OC)cc12 |
| InChI | InChI=1S/C23H20N2O6/c1-4-31-23(28)17-11-24-20(19-16(17)9-14(29-2)10-18(19)30-3)22(27)25-12-13-7-5-6-8-15(13)21(25)26/h5-11H,4,12H2,1-3H3 |
| InChIKey | ALCLYGNPJWAKRE-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 95.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|