C17H26N2 — CID 68613412
1-(1-adamantyl)-3a,4,5,6,7,7a-hexahydrobenzimidazole (PubChem CID 68613412) has the molecular formula C17H26N2 and a molecular weight of 258.41 g/mol. Its IUPAC name is 1-(1-adamantyl)-3a,4,5,6,7,7a-hexahydrobenzimidazole.
| Compound Name | 1-(1-adamantyl)-3a,4,5,6,7,7a-hexahydrobenzimidazole |
|---|---|
| PubChem CID | 68613412 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | 1-(1-adamantyl)-3a,4,5,6,7,7a-hexahydrobenzimidazole |
| SMILES | C1=NC2CCCCC2N1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C17H26N2/c1-2-4-16-15(3-1)18-11-19(16)17-8-12-5-13(9-17)7-14(6-12)10-17/h11-16H,1-10H2 |
| InChIKey | SNAFPTFLMSMRBN-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |