C15H25FN2 — CID 68613518
N,N-dibutyl-5-methyl-7-azabicyclo[4.1.0]hepta-1,3,5-trien-2-amine;hydrofluoride (PubChem CID 68613518) has the molecular formula C15H25FN2 and a molecular weight of 252.38 g/mol. Its IUPAC name is N,N-dibutyl-5-methyl-7-azabicyclo[4.1.0]hepta-1,3,5-trien-2-amine;hydrofluoride.
| Compound Name | N,N-dibutyl-5-methyl-7-azabicyclo[4.1.0]hepta-1,3,5-trien-2-amine;hydrofluoride |
|---|---|
| PubChem CID | 68613518 |
| Molecular Formula | C15H25FN2 |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.20 |
| IUPAC Name | N,N-dibutyl-5-methyl-7-azabicyclo[4.1.0]hepta-1,3,5-trien-2-amine;hydrofluoride |
| SMILES | CCCCN(CCCC)c1ccc(C)c2c1N2.F |
| InChI | InChI=1S/C15H24N2.FH/c1-4-6-10-17(11-7-5-2)13-9-8-12(3)14-15(13)16-14;/h8-9,16H,4-7,10-11H2,1-3H3;1H |
| InChIKey | AKHPMKIWGWFVPC-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 25.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|