C9H14N4O — CID 68613777
2-[amino(pyridin-4-ylmethyl)amino]propanamide (PubChem CID 68613777) has the molecular formula C9H14N4O and a molecular weight of 194.24 g/mol. Its IUPAC name is 2-[amino(pyridin-4-ylmethyl)amino]propanamide.
| Compound Name | 2-[amino(pyridin-4-ylmethyl)amino]propanamide |
|---|---|
| PubChem CID | 68613777 |
| Molecular Formula | C9H14N4O |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | 2-[amino(pyridin-4-ylmethyl)amino]propanamide |
| SMILES | CC(C(N)=O)N(N)Cc1ccncc1 |
| InChI | InChI=1S/C9H14N4O/c1-7(9(10)14)13(11)6-8-2-4-12-5-3-8/h2-5,7H,6,11H2,1H3,(H2,10,14) |
| InChIKey | ZHNSLVBTAZZOJR-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 85.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|