About 2-decylisoquinolin-2-ium bromide
2-decylisoquinolin-2-ium bromide (PubChem CID 68613957) has the molecular formula C19H28BrN
and a molecular weight of 350.34 g/mol. Its IUPAC name is 2-decylisoquinolin-2-ium bromide.
Molecular Properties
| Compound Name | 2-decylisoquinolin-2-ium bromide |
| PubChem CID | 68613957 |
| Molecular Formula | C19H28BrN |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 2-decylisoquinolin-2-ium bromide |
| SMILES | CCCCCCCCCC[n+]1ccc2ccccc2c1.[Br-] |
| InChI | InChI=1S/C19H28N.BrH/c1-2-3-4-5-6-7-8-11-15-20-16-14-18-12-9-10-13-19(18)17-20;/h9-10,12-14,16-17H,2-8,11,15H2,1H3;1H/q+1;/p-1 |
| InChIKey | PLOBFVCZSOQJSJ-UHFFFAOYSA-M |
| XLogP | 2.27 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-decylisoquinolin-2-ium bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-decylisoquinolin-2-ium bromide?
The IUPAC name of 2-decylisoquinolin-2-ium bromide (CID 68613957) is 2-decylisoquinolin-2-ium bromide.
What is the SMILES notation for 2-decylisoquinolin-2-ium bromide?
The canonical SMILES for 2-decylisoquinolin-2-ium bromide is CCCCCCCCCC[n+]1ccc2ccccc2c1.[Br-].
What is the InChIKey of 2-decylisoquinolin-2-ium bromide?
The InChIKey is PLOBFVCZSOQJSJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C19H28N.BrH/c1-2-3-4-5-6-7-8-11-15-20-16-14-18-12-9-10-13-19(18)17-20;/h9-10,12-14,16-17H,2-8,11,15H2,1H3;1H/q+1;/p-1.
What are the key properties of 2-decylisoquinolin-2-ium bromide?
2-decylisoquinolin-2-ium bromide has a molecular weight of 350.34 g/mol, XLogP of 2.27, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-decylisoquinolin-2-ium bromide is sourced from PubChem (CID 68613957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).