About [7-(2,4-dichlorophenyl)-2-ethylindazol-3-yl] methyl carbonate
[7-(2,4-dichlorophenyl)-2-ethylindazol-3-yl] methyl carbonate (PubChem CID 68614330) has the molecular formula C17H14Cl2N2O3
and a molecular weight of 365.22 g/mol. Its IUPAC name is [7-(2,4-dichlorophenyl)-2-ethylindazol-3-yl] methyl carbonate.
Molecular Properties
| Compound Name | [7-(2,4-dichlorophenyl)-2-ethylindazol-3-yl] methyl carbonate |
| PubChem CID | 68614330 |
| Molecular Formula | C17H14Cl2N2O3 |
| Molecular Weight | 365.22 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | [7-(2,4-dichlorophenyl)-2-ethylindazol-3-yl] methyl carbonate |
| SMILES | CCn1nc2c(-c3ccc(Cl)cc3Cl)cccc2c1OC(=O)OC |
| InChI | InChI=1S/C17H14Cl2N2O3/c1-3-21-16(24-17(22)23-2)13-6-4-5-12(15(13)20-21)11-8-7-10(18)9-14(11)19/h4-9H,3H2,1-2H3 |
| InChIKey | OQGPOUPECPZBLC-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 365.22 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [7-(2,4-dichlorophenyl)-2-ethylindazol-3-yl] methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [7-(2,4-dichlorophenyl)-2-ethylindazol-3-yl] methyl carbonate?
The IUPAC name of [7-(2,4-dichlorophenyl)-2-ethylindazol-3-yl] methyl carbonate (CID 68614330) is [7-(2,4-dichlorophenyl)-2-ethylindazol-3-yl] methyl carbonate.
What is the SMILES notation for [7-(2,4-dichlorophenyl)-2-ethylindazol-3-yl] methyl carbonate?
The canonical SMILES for [7-(2,4-dichlorophenyl)-2-ethylindazol-3-yl] methyl carbonate is CCn1nc2c(-c3ccc(Cl)cc3Cl)cccc2c1OC(=O)OC.
What is the InChIKey of [7-(2,4-dichlorophenyl)-2-ethylindazol-3-yl] methyl carbonate?
The InChIKey is OQGPOUPECPZBLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14Cl2N2O3/c1-3-21-16(24-17(22)23-2)13-6-4-5-12(15(13)20-21)11-8-7-10(18)9-14(11)19/h4-9H,3H2,1-2H3.
What are the key properties of [7-(2,4-dichlorophenyl)-2-ethylindazol-3-yl] methyl carbonate?
[7-(2,4-dichlorophenyl)-2-ethylindazol-3-yl] methyl carbonate has a molecular weight of 365.22 g/mol, XLogP of 5.18, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [7-(2,4-dichlorophenyl)-2-ethylindazol-3-yl] methyl carbonate is sourced from PubChem (CID 68614330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).