About N-cyclopentyl-2-(3-nitro-1,2,4-triazol-1-yl)acetamide
N-cyclopentyl-2-(3-nitro-1,2,4-triazol-1-yl)acetamide (PubChem CID 686144) has the molecular formula C9H13N5O3
and a molecular weight of 239.23 g/mol. Its IUPAC name is N-cyclopentyl-2-(3-nitro-1,2,4-triazol-1-yl)acetamide.
Molecular Properties
| Compound Name | N-cyclopentyl-2-(3-nitro-1,2,4-triazol-1-yl)acetamide |
| PubChem CID | 686144 |
| Molecular Formula | C9H13N5O3 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | N-cyclopentyl-2-(3-nitro-1,2,4-triazol-1-yl)acetamide |
| SMILES | O=C(Cn1cnc([N+](=O)[O-])n1)NC1CCCC1 |
| InChI | InChI=1S/C9H13N5O3/c15-8(11-7-3-1-2-4-7)5-13-6-10-9(12-13)14(16)17/h6-7H,1-5H2,(H,11,15) |
| InChIKey | FYURTHVEGXRKAG-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-cyclopentyl-2-(3-nitro-1,2,4-triazol-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopentyl-2-(3-nitro-1,2,4-triazol-1-yl)acetamide?
The IUPAC name of N-cyclopentyl-2-(3-nitro-1,2,4-triazol-1-yl)acetamide (CID 686144) is N-cyclopentyl-2-(3-nitro-1,2,4-triazol-1-yl)acetamide.
What is the SMILES notation for N-cyclopentyl-2-(3-nitro-1,2,4-triazol-1-yl)acetamide?
The canonical SMILES for N-cyclopentyl-2-(3-nitro-1,2,4-triazol-1-yl)acetamide is O=C(Cn1cnc([N+](=O)[O-])n1)NC1CCCC1.
What is the InChIKey of N-cyclopentyl-2-(3-nitro-1,2,4-triazol-1-yl)acetamide?
The InChIKey is FYURTHVEGXRKAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N5O3/c15-8(11-7-3-1-2-4-7)5-13-6-10-9(12-13)14(16)17/h6-7H,1-5H2,(H,11,15).
What are the key properties of N-cyclopentyl-2-(3-nitro-1,2,4-triazol-1-yl)acetamide?
N-cyclopentyl-2-(3-nitro-1,2,4-triazol-1-yl)acetamide has a molecular weight of 239.23 g/mol, XLogP of 0.25, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopentyl-2-(3-nitro-1,2,4-triazol-1-yl)acetamide is sourced from PubChem (CID 686144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).