About 2-phenylfuran;piperazine
2-phenylfuran;piperazine (PubChem CID 68614405) has the molecular formula C14H18N2O
and a molecular weight of 230.31 g/mol. Its IUPAC name is 2-phenylfuran;piperazine.
Molecular Properties
| Compound Name | 2-phenylfuran;piperazine |
| PubChem CID | 68614405 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 2-phenylfuran;piperazine |
| SMILES | C1CNCCN1.c1ccc(-c2ccco2)cc1 |
| InChI | InChI=1S/C10H8O.C4H10N2/c1-2-5-9(6-3-1)10-7-4-8-11-10;1-2-6-4-3-5-1/h1-8H;5-6H,1-4H2 |
| InChIKey | NKQBBIXTZLMCKZ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 37.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-phenylfuran;piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylfuran;piperazine?
The IUPAC name of 2-phenylfuran;piperazine (CID 68614405) is 2-phenylfuran;piperazine.
What is the SMILES notation for 2-phenylfuran;piperazine?
The canonical SMILES for 2-phenylfuran;piperazine is C1CNCCN1.c1ccc(-c2ccco2)cc1.
What is the InChIKey of 2-phenylfuran;piperazine?
The InChIKey is NKQBBIXTZLMCKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O.C4H10N2/c1-2-5-9(6-3-1)10-7-4-8-11-10;1-2-6-4-3-5-1/h1-8H;5-6H,1-4H2.
What are the key properties of 2-phenylfuran;piperazine?
2-phenylfuran;piperazine has a molecular weight of 230.31 g/mol, XLogP of 2.13, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylfuran;piperazine is sourced from PubChem (CID 68614405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).