About dimethyl(phenyl)borane;4-propan-2-ylpyridine
dimethyl(phenyl)borane;4-propan-2-ylpyridine (PubChem CID 68614411) has the molecular formula C16H22BN
and a molecular weight of 239.17 g/mol. Its IUPAC name is dimethyl(phenyl)borane;4-propan-2-ylpyridine.
Molecular Properties
| Compound Name | dimethyl(phenyl)borane;4-propan-2-ylpyridine |
| PubChem CID | 68614411 |
| Molecular Formula | C16H22BN |
| Molecular Weight | 239.17 g/mol |
| Exact Mass | 239.18 |
| IUPAC Name | dimethyl(phenyl)borane;4-propan-2-ylpyridine |
| SMILES | CB(C)c1ccccc1.CC(C)c1ccncc1 |
| InChI | InChI=1S/C8H11B.C8H11N/c1-9(2)8-6-4-3-5-7-8;1-7(2)8-3-5-9-6-4-8/h2*3-7H,1-2H3 |
| InChIKey | QYVUQMOBGUZSMX-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.17 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dimethyl(phenyl)borane;4-propan-2-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl(phenyl)borane;4-propan-2-ylpyridine?
The IUPAC name of dimethyl(phenyl)borane;4-propan-2-ylpyridine (CID 68614411) is dimethyl(phenyl)borane;4-propan-2-ylpyridine.
What is the SMILES notation for dimethyl(phenyl)borane;4-propan-2-ylpyridine?
The canonical SMILES for dimethyl(phenyl)borane;4-propan-2-ylpyridine is CB(C)c1ccccc1.CC(C)c1ccncc1.
What is the InChIKey of dimethyl(phenyl)borane;4-propan-2-ylpyridine?
The InChIKey is QYVUQMOBGUZSMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11B.C8H11N/c1-9(2)8-6-4-3-5-7-8;1-7(2)8-3-5-9-6-4-8/h2*3-7H,1-2H3.
What are the key properties of dimethyl(phenyl)borane;4-propan-2-ylpyridine?
dimethyl(phenyl)borane;4-propan-2-ylpyridine has a molecular weight of 239.17 g/mol, XLogP of 3.85, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl(phenyl)borane;4-propan-2-ylpyridine is sourced from PubChem (CID 68614411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).