C20H29ClN2O2Si — CID 68614831
8-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-chlorophenyl]-6,7-dihydro-5H-imidazo[1,5-a]pyridin-8-ol (PubChem CID 68614831) has the molecular formula C20H29ClN2O2Si and a molecular weight of 393.00 g/mol. Its IUPAC name is 8-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-chlorophenyl]-6,7-dihydro-5H-imidazo[1,5-a]pyridin-8-ol.
| Compound Name | 8-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-chlorophenyl]-6,7-dihydro-5H-imidazo[1,5-a]pyridin-8-ol |
|---|---|
| PubChem CID | 68614831 |
| Molecular Formula | C20H29ClN2O2Si |
| Molecular Weight | 393.00 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 8-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-chlorophenyl]-6,7-dihydro-5H-imidazo[1,5-a]pyridin-8-ol |
| SMILES | CC(C)(C)[Si](C)(C)OCc1ccc(Cl)cc1C1(O)CCCn2cncc21 |
| InChI | InChI=1S/C20H29ClN2O2Si/c1-19(2,3)26(4,5)25-13-15-7-8-16(21)11-17(15)20(24)9-6-10-23-14-22-12-18(20)23/h7-8,11-12,14,24H,6,9-10,13H2,1-5H3 |
| InChIKey | VWQAKFJLCGVAJZ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.00 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|