C24H21F3N2O3 — CID 68614924
2-[2-[2-[[benzoyl(ethyl)amino]methyl]-4-(trifluoromethyl)phenyl]-4-pyridinyl]acetic acid (PubChem CID 68614924) has the molecular formula C24H21F3N2O3 and a molecular weight of 442.44 g/mol. Its IUPAC name is 2-[2-[2-[[benzoyl(ethyl)amino]methyl]-4-(trifluoromethyl)phenyl]-4-pyridinyl]acetic acid.
| Compound Name | 2-[2-[2-[[benzoyl(ethyl)amino]methyl]-4-(trifluoromethyl)phenyl]-4-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 68614924 |
| Molecular Formula | C24H21F3N2O3 |
| Molecular Weight | 442.44 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | 2-[2-[2-[[benzoyl(ethyl)amino]methyl]-4-(trifluoromethyl)phenyl]-4-pyridinyl]acetic acid |
| SMILES | CCN(Cc1cc(C(F)(F)F)ccc1-c1cc(CC(=O)O)ccn1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C24H21F3N2O3/c1-2-29(23(32)17-6-4-3-5-7-17)15-18-14-19(24(25,26)27)8-9-20(18)21-12-16(10-11-28-21)13-22(30)31/h3-12,14H,2,13,15H2,1H3,(H,30,31) |
| InChIKey | JBNRQCIZPGGORD-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.44 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |