C15H10Cl4N4O — CID 6861508
1,3-bis[(E)-(2,4-dichlorophenyl)methylideneamino]urea (PubChem CID 6861508) has the molecular formula C15H10Cl4N4O and a molecular weight of 404.08 g/mol. Its IUPAC name is 1,3-bis[(E)-(2,4-dichlorophenyl)methylideneamino]urea.
| Compound Name | 1,3-bis[(E)-(2,4-dichlorophenyl)methylideneamino]urea |
|---|---|
| PubChem CID | 6861508 |
| Molecular Formula | C15H10Cl4N4O |
| Molecular Weight | 404.08 g/mol |
| Exact Mass | 401.96 |
| IUPAC Name | 1,3-bis[(E)-(2,4-dichlorophenyl)methylideneamino]urea |
| SMILES | O=C(N/N=C/c1ccc(Cl)cc1Cl)N/N=C/c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H10Cl4N4O/c16-11-3-1-9(13(18)5-11)7-20-22-15(24)23-21-8-10-2-4-12(17)6-14(10)19/h1-8H,(H2,22,23,24)/b20-7+,21-8+ |
| InChIKey | AFJFPVJYDDLXJN-BPYXDGQXSA-N |
| XLogP | 4.97 |
| TPSA | 65.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.08 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|