C22H25FN2O4 — CID 68615181
tert-butyl N-[1-[4-[(3-fluorophenyl)methoxy]phenyl]-5-oxopyrrolidin-3-yl]carbamate (PubChem CID 68615181) has the molecular formula C22H25FN2O4 and a molecular weight of 400.45 g/mol. Its IUPAC name is tert-butyl N-[1-[4-[(3-fluorophenyl)methoxy]phenyl]-5-oxopyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[4-[(3-fluorophenyl)methoxy]phenyl]-5-oxopyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 68615181 |
| Molecular Formula | C22H25FN2O4 |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | tert-butyl N-[1-[4-[(3-fluorophenyl)methoxy]phenyl]-5-oxopyrrolidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CC(=O)N(c2ccc(OCc3cccc(F)c3)cc2)C1 |
| InChI | InChI=1S/C22H25FN2O4/c1-22(2,3)29-21(27)24-17-12-20(26)25(13-17)18-7-9-19(10-8-18)28-14-15-5-4-6-16(23)11-15/h4-11,17H,12-14H2,1-3H3,(H,24,27) |
| InChIKey | GHVNEGRXJHQBIJ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |