About N-ethyl-N-propan-2-ylpropan-2-amine;1-methylpiperidine
N-ethyl-N-propan-2-ylpropan-2-amine;1-methylpiperidine (PubChem CID 68615269) has the molecular formula C14H32N2
and a molecular weight of 228.42 g/mol. Its IUPAC name is N-ethyl-N-propan-2-ylpropan-2-amine;1-methylpiperidine.
Molecular Properties
| Compound Name | N-ethyl-N-propan-2-ylpropan-2-amine;1-methylpiperidine |
| PubChem CID | 68615269 |
| Molecular Formula | C14H32N2 |
| Molecular Weight | 228.42 g/mol |
| Exact Mass | 228.26 |
| IUPAC Name | N-ethyl-N-propan-2-ylpropan-2-amine;1-methylpiperidine |
| SMILES | CCN(C(C)C)C(C)C.CN1CCCCC1 |
| InChI | InChI=1S/C8H19N.C6H13N/c1-6-9(7(2)3)8(4)5;1-7-5-3-2-4-6-7/h7-8H,6H2,1-5H3;2-6H2,1H3 |
| InChIKey | UBOIZWPITYCTSX-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.42 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-ethyl-N-propan-2-ylpropan-2-amine;1-methylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-propan-2-ylpropan-2-amine;1-methylpiperidine?
The IUPAC name of N-ethyl-N-propan-2-ylpropan-2-amine;1-methylpiperidine (CID 68615269) is N-ethyl-N-propan-2-ylpropan-2-amine;1-methylpiperidine.
What is the SMILES notation for N-ethyl-N-propan-2-ylpropan-2-amine;1-methylpiperidine?
The canonical SMILES for N-ethyl-N-propan-2-ylpropan-2-amine;1-methylpiperidine is CCN(C(C)C)C(C)C.CN1CCCCC1.
What is the InChIKey of N-ethyl-N-propan-2-ylpropan-2-amine;1-methylpiperidine?
The InChIKey is UBOIZWPITYCTSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19N.C6H13N/c1-6-9(7(2)3)8(4)5;1-7-5-3-2-4-6-7/h7-8H,6H2,1-5H3;2-6H2,1H3.
What are the key properties of N-ethyl-N-propan-2-ylpropan-2-amine;1-methylpiperidine?
N-ethyl-N-propan-2-ylpropan-2-amine;1-methylpiperidine has a molecular weight of 228.42 g/mol, XLogP of 3.23, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-propan-2-ylpropan-2-amine;1-methylpiperidine is sourced from PubChem (CID 68615269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).