C21H15N3O2 — CID 68615384
6-benzoyl-N-phenylimidazo[1,2-a]pyridine-2-carboxamide (PubChem CID 68615384) has the molecular formula C21H15N3O2 and a molecular weight of 341.37 g/mol. Its IUPAC name is 6-benzoyl-N-phenylimidazo[1,2-a]pyridine-2-carboxamide.
| Compound Name | 6-benzoyl-N-phenylimidazo[1,2-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 68615384 |
| Molecular Formula | C21H15N3O2 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 6-benzoyl-N-phenylimidazo[1,2-a]pyridine-2-carboxamide |
| SMILES | O=C(c1ccccc1)c1ccc2nc(C(=O)Nc3ccccc3)cn2c1 |
| InChI | InChI=1S/C21H15N3O2/c25-20(15-7-3-1-4-8-15)16-11-12-19-23-18(14-24(19)13-16)21(26)22-17-9-5-2-6-10-17/h1-14H,(H,22,26) |
| InChIKey | BDRBJLZTIYWINU-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |