About 3-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)sulfanylmethyl]benzamide
3-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)sulfanylmethyl]benzamide (PubChem CID 68615669) has the molecular formula C21H15N5OS
and a molecular weight of 385.45 g/mol. Its IUPAC name is 3-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)sulfanylmethyl]benzamide.
Molecular Properties
| Compound Name | 3-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)sulfanylmethyl]benzamide |
| PubChem CID | 68615669 |
| Molecular Formula | C21H15N5OS |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 3-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)sulfanylmethyl]benzamide |
| SMILES | N#Cc1c(N)nc(SCc2cccc(C(N)=O)c2)c(C#N)c1-c1ccccc1 |
| InChI | InChI=1S/C21H15N5OS/c22-10-16-18(14-6-2-1-3-7-14)17(11-23)21(26-19(16)24)28-12-13-5-4-8-15(9-13)20(25)27/h1-9H,12H2,(H2,24,26)(H2,25,27) |
| InChIKey | CNCRFHGLUXOHFK-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 129.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)sulfanylmethyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)sulfanylmethyl]benzamide?
The IUPAC name of 3-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)sulfanylmethyl]benzamide (CID 68615669) is 3-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)sulfanylmethyl]benzamide.
What is the SMILES notation for 3-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)sulfanylmethyl]benzamide?
The canonical SMILES for 3-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)sulfanylmethyl]benzamide is N#Cc1c(N)nc(SCc2cccc(C(N)=O)c2)c(C#N)c1-c1ccccc1.
What is the InChIKey of 3-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)sulfanylmethyl]benzamide?
The InChIKey is CNCRFHGLUXOHFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15N5OS/c22-10-16-18(14-6-2-1-3-7-14)17(11-23)21(26-19(16)24)28-12-13-5-4-8-15(9-13)20(25)27/h1-9H,12H2,(H2,24,26)(H2,25,27).
What are the key properties of 3-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)sulfanylmethyl]benzamide?
3-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)sulfanylmethyl]benzamide has a molecular weight of 385.45 g/mol, XLogP of 3.47, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)sulfanylmethyl]benzamide is sourced from PubChem (CID 68615669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).