About N,N-diethylethanamine;oxolane
N,N-diethylethanamine;oxolane (PubChem CID 68616177) has the molecular formula C10H23NO
and a molecular weight of 173.30 g/mol. Its IUPAC name is N,N-diethylethanamine;oxolane.
Molecular Properties
| Compound Name | N,N-diethylethanamine;oxolane |
| PubChem CID | 68616177 |
| Molecular Formula | C10H23NO |
| Molecular Weight | 173.30 g/mol |
| Exact Mass | 173.18 |
| IUPAC Name | N,N-diethylethanamine;oxolane |
| SMILES | C1CCOC1.CCN(CC)CC |
| InChI | InChI=1S/C6H15N.C4H8O/c1-4-7(5-2)6-3;1-2-4-5-3-1/h4-6H2,1-3H3;1-4H2 |
| InChIKey | VSPPONOIKZXUBJ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.30 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N-diethylethanamine;oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethylethanamine;oxolane?
The IUPAC name of N,N-diethylethanamine;oxolane (CID 68616177) is N,N-diethylethanamine;oxolane.
What is the SMILES notation for N,N-diethylethanamine;oxolane?
The canonical SMILES for N,N-diethylethanamine;oxolane is C1CCOC1.CCN(CC)CC.
What is the InChIKey of N,N-diethylethanamine;oxolane?
The InChIKey is VSPPONOIKZXUBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.C4H8O/c1-4-7(5-2)6-3;1-2-4-5-3-1/h4-6H2,1-3H3;1-4H2.
What are the key properties of N,N-diethylethanamine;oxolane?
N,N-diethylethanamine;oxolane has a molecular weight of 173.30 g/mol, XLogP of 2.14, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylethanamine;oxolane is sourced from PubChem (CID 68616177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).