About ethyl N-[(E)-(2,4-dichlorophenyl)methylideneamino]carbamate
ethyl N-[(E)-(2,4-dichlorophenyl)methylideneamino]carbamate (PubChem CID 6861625) has the molecular formula C10H10Cl2N2O2
and a molecular weight of 261.11 g/mol. Its IUPAC name is ethyl N-[(E)-(2,4-dichlorophenyl)methylideneamino]carbamate.
Molecular Properties
| Compound Name | ethyl N-[(E)-(2,4-dichlorophenyl)methylideneamino]carbamate |
| PubChem CID | 6861625 |
| Molecular Formula | C10H10Cl2N2O2 |
| Molecular Weight | 261.11 g/mol |
| Exact Mass | 260.01 |
| IUPAC Name | ethyl N-[(E)-(2,4-dichlorophenyl)methylideneamino]carbamate |
| SMILES | CCOC(=O)N/N=C/c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H10Cl2N2O2/c1-2-16-10(15)14-13-6-7-3-4-8(11)5-9(7)12/h3-6H,2H2,1H3,(H,14,15)/b13-6+ |
| InChIKey | ZMIBUQWEEDLLRS-AWNIVKPZSA-N |
| XLogP | 3.07 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.11 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-[(E)-(2,4-dichlorophenyl)methylideneamino]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[(E)-(2,4-dichlorophenyl)methylideneamino]carbamate?
The IUPAC name of ethyl N-[(E)-(2,4-dichlorophenyl)methylideneamino]carbamate (CID 6861625) is ethyl N-[(E)-(2,4-dichlorophenyl)methylideneamino]carbamate.
What is the SMILES notation for ethyl N-[(E)-(2,4-dichlorophenyl)methylideneamino]carbamate?
The canonical SMILES for ethyl N-[(E)-(2,4-dichlorophenyl)methylideneamino]carbamate is CCOC(=O)N/N=C/c1ccc(Cl)cc1Cl.
What is the InChIKey of ethyl N-[(E)-(2,4-dichlorophenyl)methylideneamino]carbamate?
The InChIKey is ZMIBUQWEEDLLRS-AWNIVKPZSA-N. The full InChI is InChI=1S/C10H10Cl2N2O2/c1-2-16-10(15)14-13-6-7-3-4-8(11)5-9(7)12/h3-6H,2H2,1H3,(H,14,15)/b13-6+.
What are the key properties of ethyl N-[(E)-(2,4-dichlorophenyl)methylideneamino]carbamate?
ethyl N-[(E)-(2,4-dichlorophenyl)methylideneamino]carbamate has a molecular weight of 261.11 g/mol, XLogP of 3.07, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[(E)-(2,4-dichlorophenyl)methylideneamino]carbamate is sourced from PubChem (CID 6861625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).