C29H35NO8 — CID 68616362
[8,9-dimethoxy-3,5,5-trimethyl-2-(3,4,5-trimethoxyphenyl)-6H-pyrrolo[2,1-a]isoquinolin-1-yl] ethyl carbonate (PubChem CID 68616362) has the molecular formula C29H35NO8 and a molecular weight of 525.60 g/mol. Its IUPAC name is [8,9-dimethoxy-3,5,5-trimethyl-2-(3,4,5-trimethoxyphenyl)-6H-pyrrolo[2,1-a]isoquinolin-1-yl] ethyl carbonate.
| Compound Name | [8,9-dimethoxy-3,5,5-trimethyl-2-(3,4,5-trimethoxyphenyl)-6H-pyrrolo[2,1-a]isoquinolin-1-yl] ethyl carbonate |
|---|---|
| PubChem CID | 68616362 |
| Molecular Formula | C29H35NO8 |
| Molecular Weight | 525.60 g/mol |
| Exact Mass | 525.24 |
| IUPAC Name | [8,9-dimethoxy-3,5,5-trimethyl-2-(3,4,5-trimethoxyphenyl)-6H-pyrrolo[2,1-a]isoquinolin-1-yl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1c(-c2cc(OC)c(OC)c(OC)c2)c(C)n2c1-c1cc(OC)c(OC)cc1CC2(C)C |
| InChI | InChI=1S/C29H35NO8/c1-10-37-28(31)38-27-24(17-11-22(34-7)26(36-9)23(12-17)35-8)16(2)30-25(27)19-14-21(33-6)20(32-5)13-18(19)15-29(30,3)4/h11-14H,10,15H2,1-9H3 |
| InChIKey | XOAHLSINCAAHPF-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 86.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.60 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |