C32H42F3N3O5 — CID 68616998
N-[[4-[[cyclopropyl-[2-(2,3,5-trifluorophenyl)acetyl]amino]methyl]pyrrolidin-3-yl]methyl]-4-methoxy-3-(3-methoxypropoxy)-N-propan-2-ylbenzamide (PubChem CID 68616998) has the molecular formula C32H42F3N3O5 and a molecular weight of 605.70 g/mol. Its IUPAC name is N-[[4-[[cyclopropyl-[2-(2,3,5-trifluorophenyl)acetyl]amino]methyl]pyrrolidin-3-yl]methyl]-4-methoxy-3-(3-methoxypropoxy)-N-propan-2-ylbenzamide.
| Compound Name | N-[[4-[[cyclopropyl-[2-(2,3,5-trifluorophenyl)acetyl]amino]methyl]pyrrolidin-3-yl]methyl]-4-methoxy-3-(3-methoxypropoxy)-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 68616998 |
| Molecular Formula | C32H42F3N3O5 |
| Molecular Weight | 605.70 g/mol |
| Exact Mass | 605.31 |
| IUPAC Name | N-[[4-[[cyclopropyl-[2-(2,3,5-trifluorophenyl)acetyl]amino]methyl]pyrrolidin-3-yl]methyl]-4-methoxy-3-(3-methoxypropoxy)-N-propan-2-ylbenzamide |
| SMILES | COCCCOc1cc(C(=O)N(CC2CNCC2CN(C(=O)Cc2cc(F)cc(F)c2F)C2CC2)C(C)C)ccc1OC |
| InChI | InChI=1S/C32H42F3N3O5/c1-20(2)37(32(40)21-6-9-28(42-4)29(13-21)43-11-5-10-41-3)18-23-16-36-17-24(23)19-38(26-7-8-26)30(39)14-22-12-25(33)15-27(34)31(22)35/h6,9,12-13,15,20,23-24,26,36H,5,7-8,10-11,14,16-19H2,1-4H3 |
| InChIKey | DFFGHBTVFSDIPZ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.70 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|