About 3-[1-(2-methoxyethoxymethyl)-3-(2-methoxyphenyl)pyrazolo[5,4-b]pyridin-5-yl]benzoic acid
3-[1-(2-methoxyethoxymethyl)-3-(2-methoxyphenyl)pyrazolo[5,4-b]pyridin-5-yl]benzoic acid (PubChem CID 68617162) has the molecular formula C24H23N3O5
and a molecular weight of 433.46 g/mol. Its IUPAC name is 3-[1-(2-methoxyethoxymethyl)-3-(2-methoxyphenyl)pyrazolo[5,4-b]pyridin-5-yl]benzoic acid.
Molecular Properties
| Compound Name | 3-[1-(2-methoxyethoxymethyl)-3-(2-methoxyphenyl)pyrazolo[5,4-b]pyridin-5-yl]benzoic acid |
| PubChem CID | 68617162 |
| Molecular Formula | C24H23N3O5 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | 3-[1-(2-methoxyethoxymethyl)-3-(2-methoxyphenyl)pyrazolo[5,4-b]pyridin-5-yl]benzoic acid |
| SMILES | COCCOCn1nc(-c2ccccc2OC)c2cc(-c3cccc(C(=O)O)c3)cnc21 |
| InChI | InChI=1S/C24H23N3O5/c1-30-10-11-32-15-27-23-20(22(26-27)19-8-3-4-9-21(19)31-2)13-18(14-25-23)16-6-5-7-17(12-16)24(28)29/h3-9,12-14H,10-11,15H2,1-2H3,(H,28,29) |
| InChIKey | HAIVMVUOWOTKRA-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 95.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[1-(2-methoxyethoxymethyl)-3-(2-methoxyphenyl)pyrazolo[5,4-b]pyridin-5-yl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-(2-methoxyethoxymethyl)-3-(2-methoxyphenyl)pyrazolo[5,4-b]pyridin-5-yl]benzoic acid?
The IUPAC name of 3-[1-(2-methoxyethoxymethyl)-3-(2-methoxyphenyl)pyrazolo[5,4-b]pyridin-5-yl]benzoic acid (CID 68617162) is 3-[1-(2-methoxyethoxymethyl)-3-(2-methoxyphenyl)pyrazolo[5,4-b]pyridin-5-yl]benzoic acid.
What is the SMILES notation for 3-[1-(2-methoxyethoxymethyl)-3-(2-methoxyphenyl)pyrazolo[5,4-b]pyridin-5-yl]benzoic acid?
The canonical SMILES for 3-[1-(2-methoxyethoxymethyl)-3-(2-methoxyphenyl)pyrazolo[5,4-b]pyridin-5-yl]benzoic acid is COCCOCn1nc(-c2ccccc2OC)c2cc(-c3cccc(C(=O)O)c3)cnc21.
What is the InChIKey of 3-[1-(2-methoxyethoxymethyl)-3-(2-methoxyphenyl)pyrazolo[5,4-b]pyridin-5-yl]benzoic acid?
The InChIKey is HAIVMVUOWOTKRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23N3O5/c1-30-10-11-32-15-27-23-20(22(26-27)19-8-3-4-9-21(19)31-2)13-18(14-25-23)16-6-5-7-17(12-16)24(28)29/h3-9,12-14H,10-11,15H2,1-2H3,(H,28,29).
What are the key properties of 3-[1-(2-methoxyethoxymethyl)-3-(2-methoxyphenyl)pyrazolo[5,4-b]pyridin-5-yl]benzoic acid?
3-[1-(2-methoxyethoxymethyl)-3-(2-methoxyphenyl)pyrazolo[5,4-b]pyridin-5-yl]benzoic acid has a molecular weight of 433.46 g/mol, XLogP of 4.09, 9 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(2-methoxyethoxymethyl)-3-(2-methoxyphenyl)pyrazolo[5,4-b]pyridin-5-yl]benzoic acid is sourced from PubChem (CID 68617162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).