C16H26O3Si — CID 68617262
2-[(1R,5R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-bicyclo[3.2.0]hept-3-enylidene]acetic acid (PubChem CID 68617262) has the molecular formula C16H26O3Si and a molecular weight of 294.47 g/mol. Its IUPAC name is 2-[(1R,5R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-bicyclo[3.2.0]hept-3-enylidene]acetic acid.
| Compound Name | 2-[(1R,5R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-bicyclo[3.2.0]hept-3-enylidene]acetic acid |
|---|---|
| PubChem CID | 68617262 |
| Molecular Formula | C16H26O3Si |
| Molecular Weight | 294.47 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 2-[(1R,5R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-bicyclo[3.2.0]hept-3-enylidene]acetic acid |
| SMILES | CC(C)(C)[Si](C)(C)OCC1=C[C@@H]2C(=CC(=O)O)C[C@@H]2C1 |
| InChI | InChI=1S/C16H26O3Si/c1-16(2,3)20(4,5)19-10-11-6-12-8-13(9-15(17)18)14(12)7-11/h7,9,12,14H,6,8,10H2,1-5H3,(H,17,18)/t12-,14-/m0/s1 |
| InChIKey | COQNUDFYLYJNOE-JSGCOSHPSA-N |
| XLogP | 3.99 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.47 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|