C24H20N6O2 — CID 68618277
ethyl 5-[2-(3-cyano-5-methylanilino)-4-pyrrol-1-ylpyrimidin-5-yl]pyridine-3-carboxylate (PubChem CID 68618277) has the molecular formula C24H20N6O2 and a molecular weight of 424.46 g/mol. Its IUPAC name is ethyl 5-[2-(3-cyano-5-methylanilino)-4-pyrrol-1-ylpyrimidin-5-yl]pyridine-3-carboxylate.
| Compound Name | ethyl 5-[2-(3-cyano-5-methylanilino)-4-pyrrol-1-ylpyrimidin-5-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 68618277 |
| Molecular Formula | C24H20N6O2 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | ethyl 5-[2-(3-cyano-5-methylanilino)-4-pyrrol-1-ylpyrimidin-5-yl]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cncc(-c2cnc(Nc3cc(C)cc(C#N)c3)nc2-n2cccc2)c1 |
| InChI | InChI=1S/C24H20N6O2/c1-3-32-23(31)19-11-18(13-26-14-19)21-15-27-24(29-22(21)30-6-4-5-7-30)28-20-9-16(2)8-17(10-20)12-25/h4-11,13-15H,3H2,1-2H3,(H,27,28,29) |
| InChIKey | KYXCONYRGCBNRL-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 105.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |