About cyclohexa-2,5-diene-1,4-dione;3-(3-ethyl-1-methylazepan-3-yl)phenol
cyclohexa-2,5-diene-1,4-dione;3-(3-ethyl-1-methylazepan-3-yl)phenol (PubChem CID 68618319) has the molecular formula C21H27NO3
and a molecular weight of 341.45 g/mol. Its IUPAC name is cyclohexa-2,5-diene-1,4-dione;3-(3-ethyl-1-methylazepan-3-yl)phenol.
Molecular Properties
| Compound Name | cyclohexa-2,5-diene-1,4-dione;3-(3-ethyl-1-methylazepan-3-yl)phenol |
| PubChem CID | 68618319 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | cyclohexa-2,5-diene-1,4-dione;3-(3-ethyl-1-methylazepan-3-yl)phenol |
| SMILES | CCC1(c2cccc(O)c2)CCCCN(C)C1.O=C1C=CC(=O)C=C1 |
| InChI | InChI=1S/C15H23NO.C6H4O2/c1-3-15(9-4-5-10-16(2)12-15)13-7-6-8-14(17)11-13;7-5-1-2-6(8)4-3-5/h6-8,11,17H,3-5,9-10,12H2,1-2H3;1-4H |
| InChIKey | YWXNWRRGXIREAZ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|
Analyze cyclohexa-2,5-diene-1,4-dione;3-(3-ethyl-1-methylazepan-3-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexa-2,5-diene-1,4-dione;3-(3-ethyl-1-methylazepan-3-yl)phenol?
The IUPAC name of cyclohexa-2,5-diene-1,4-dione;3-(3-ethyl-1-methylazepan-3-yl)phenol (CID 68618319) is cyclohexa-2,5-diene-1,4-dione;3-(3-ethyl-1-methylazepan-3-yl)phenol.
What is the SMILES notation for cyclohexa-2,5-diene-1,4-dione;3-(3-ethyl-1-methylazepan-3-yl)phenol?
The canonical SMILES for cyclohexa-2,5-diene-1,4-dione;3-(3-ethyl-1-methylazepan-3-yl)phenol is CCC1(c2cccc(O)c2)CCCCN(C)C1.O=C1C=CC(=O)C=C1.
What is the InChIKey of cyclohexa-2,5-diene-1,4-dione;3-(3-ethyl-1-methylazepan-3-yl)phenol?
The InChIKey is YWXNWRRGXIREAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO.C6H4O2/c1-3-15(9-4-5-10-16(2)12-15)13-7-6-8-14(17)11-13;7-5-1-2-6(8)4-3-5/h6-8,11,17H,3-5,9-10,12H2,1-2H3;1-4H.
What are the key properties of cyclohexa-2,5-diene-1,4-dione;3-(3-ethyl-1-methylazepan-3-yl)phenol?
cyclohexa-2,5-diene-1,4-dione;3-(3-ethyl-1-methylazepan-3-yl)phenol has a molecular weight of 341.45 g/mol, XLogP of 3.41, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexa-2,5-diene-1,4-dione;3-(3-ethyl-1-methylazepan-3-yl)phenol is sourced from PubChem (CID 68618319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).