About (2S)-2-[4-[[1-(1,3-thiazol-2-ylmethyl)indazol-5-yl]amino]quinazolin-5-yl]oxypropanoic acid
(2S)-2-[4-[[1-(1,3-thiazol-2-ylmethyl)indazol-5-yl]amino]quinazolin-5-yl]oxypropanoic acid (PubChem CID 68618394) has the molecular formula C22H18N6O3S
and a molecular weight of 446.49 g/mol. Its IUPAC name is (2S)-2-[4-[[1-(1,3-thiazol-2-ylmethyl)indazol-5-yl]amino]quinazolin-5-yl]oxypropanoic acid.
Molecular Properties
| Compound Name | (2S)-2-[4-[[1-(1,3-thiazol-2-ylmethyl)indazol-5-yl]amino]quinazolin-5-yl]oxypropanoic acid |
| PubChem CID | 68618394 |
| Molecular Formula | C22H18N6O3S |
| Molecular Weight | 446.49 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | (2S)-2-[4-[[1-(1,3-thiazol-2-ylmethyl)indazol-5-yl]amino]quinazolin-5-yl]oxypropanoic acid |
| SMILES | C[C@H](Oc1cccc2ncnc(Nc3ccc4c(cnn4Cc4nccs4)c3)c12)C(=O)O |
| InChI | InChI=1S/C22H18N6O3S/c1-13(22(29)30)31-18-4-2-3-16-20(18)21(25-12-24-16)27-15-5-6-17-14(9-15)10-26-28(17)11-19-23-7-8-32-19/h2-10,12-13H,11H2,1H3,(H,29,30)(H,24,25,27)/t13-/m0/s1 |
| InChIKey | YMYXOKGILOEYKS-ZDUSSCGKSA-N |
| XLogP | 4.08 |
| TPSA | 115.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 446.49 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze (2S)-2-[4-[[1-(1,3-thiazol-2-ylmethyl)indazol-5-yl]amino]quinazolin-5-yl]oxypropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[4-[[1-(1,3-thiazol-2-ylmethyl)indazol-5-yl]amino]quinazolin-5-yl]oxypropanoic acid?
The IUPAC name of (2S)-2-[4-[[1-(1,3-thiazol-2-ylmethyl)indazol-5-yl]amino]quinazolin-5-yl]oxypropanoic acid (CID 68618394) is (2S)-2-[4-[[1-(1,3-thiazol-2-ylmethyl)indazol-5-yl]amino]quinazolin-5-yl]oxypropanoic acid.
What is the SMILES notation for (2S)-2-[4-[[1-(1,3-thiazol-2-ylmethyl)indazol-5-yl]amino]quinazolin-5-yl]oxypropanoic acid?
The canonical SMILES for (2S)-2-[4-[[1-(1,3-thiazol-2-ylmethyl)indazol-5-yl]amino]quinazolin-5-yl]oxypropanoic acid is C[C@H](Oc1cccc2ncnc(Nc3ccc4c(cnn4Cc4nccs4)c3)c12)C(=O)O.
What is the InChIKey of (2S)-2-[4-[[1-(1,3-thiazol-2-ylmethyl)indazol-5-yl]amino]quinazolin-5-yl]oxypropanoic acid?
The InChIKey is YMYXOKGILOEYKS-ZDUSSCGKSA-N. The full InChI is InChI=1S/C22H18N6O3S/c1-13(22(29)30)31-18-4-2-3-16-20(18)21(25-12-24-16)27-15-5-6-17-14(9-15)10-26-28(17)11-19-23-7-8-32-19/h2-10,12-13H,11H2,1H3,(H,29,30)(H,24,25,27)/t13-/m0/s1.
What are the key properties of (2S)-2-[4-[[1-(1,3-thiazol-2-ylmethyl)indazol-5-yl]amino]quinazolin-5-yl]oxypropanoic acid?
(2S)-2-[4-[[1-(1,3-thiazol-2-ylmethyl)indazol-5-yl]amino]quinazolin-5-yl]oxypropanoic acid has a molecular weight of 446.49 g/mol, XLogP of 4.08, 7 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[4-[[1-(1,3-thiazol-2-ylmethyl)indazol-5-yl]amino]quinazolin-5-yl]oxypropanoic acid is sourced from PubChem (CID 68618394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).