C28H24ClNO5S — CID 68618654
2-[4-[[[3-chloro-4-(4-phenoxyphenyl)phenyl]methyl-sulfinoamino]methyl]phenyl]acetic acid (PubChem CID 68618654) has the molecular formula C28H24ClNO5S and a molecular weight of 522.02 g/mol. Its IUPAC name is 2-[4-[[[3-chloro-4-(4-phenoxyphenyl)phenyl]methyl-sulfinoamino]methyl]phenyl]acetic acid.
| Compound Name | 2-[4-[[[3-chloro-4-(4-phenoxyphenyl)phenyl]methyl-sulfinoamino]methyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 68618654 |
| Molecular Formula | C28H24ClNO5S |
| Molecular Weight | 522.02 g/mol |
| Exact Mass | 521.11 |
| IUPAC Name | 2-[4-[[[3-chloro-4-(4-phenoxyphenyl)phenyl]methyl-sulfinoamino]methyl]phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(CN(Cc2ccc(-c3ccc(Oc4ccccc4)cc3)c(Cl)c2)S(=O)O)cc1 |
| InChI | InChI=1S/C28H24ClNO5S/c29-27-16-22(19-30(36(33)34)18-21-8-6-20(7-9-21)17-28(31)32)10-15-26(27)23-11-13-25(14-12-23)35-24-4-2-1-3-5-24/h1-16H,17-19H2,(H,31,32)(H,33,34) |
| InChIKey | MNYPMLZFLNOUEK-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.02 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|