About 2-(3,4-dihydro-1H-isoquinolin-2-yl)-4-phenyl-1,3-thiazole
2-(3,4-dihydro-1H-isoquinolin-2-yl)-4-phenyl-1,3-thiazole (PubChem CID 686187) has the molecular formula C18H16N2S
and a molecular weight of 292.41 g/mol. Its IUPAC name is 2-(3,4-dihydro-1H-isoquinolin-2-yl)-4-phenyl-1,3-thiazole.
Molecular Properties
| Compound Name | 2-(3,4-dihydro-1H-isoquinolin-2-yl)-4-phenyl-1,3-thiazole |
| PubChem CID | 686187 |
| Molecular Formula | C18H16N2S |
| Molecular Weight | 292.41 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 2-(3,4-dihydro-1H-isoquinolin-2-yl)-4-phenyl-1,3-thiazole |
| SMILES | c1ccc(-c2csc(N3CCc4ccccc4C3)n2)cc1 |
| InChI | InChI=1S/C18H16N2S/c1-2-7-15(8-3-1)17-13-21-18(19-17)20-11-10-14-6-4-5-9-16(14)12-20/h1-9,13H,10-12H2 |
| InChIKey | CDDCAFVGKIIDPG-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.41 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3,4-dihydro-1H-isoquinolin-2-yl)-4-phenyl-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dihydro-1H-isoquinolin-2-yl)-4-phenyl-1,3-thiazole?
The IUPAC name of 2-(3,4-dihydro-1H-isoquinolin-2-yl)-4-phenyl-1,3-thiazole (CID 686187) is 2-(3,4-dihydro-1H-isoquinolin-2-yl)-4-phenyl-1,3-thiazole.
What is the SMILES notation for 2-(3,4-dihydro-1H-isoquinolin-2-yl)-4-phenyl-1,3-thiazole?
The canonical SMILES for 2-(3,4-dihydro-1H-isoquinolin-2-yl)-4-phenyl-1,3-thiazole is c1ccc(-c2csc(N3CCc4ccccc4C3)n2)cc1.
What is the InChIKey of 2-(3,4-dihydro-1H-isoquinolin-2-yl)-4-phenyl-1,3-thiazole?
The InChIKey is CDDCAFVGKIIDPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N2S/c1-2-7-15(8-3-1)17-13-21-18(19-17)20-11-10-14-6-4-5-9-16(14)12-20/h1-9,13H,10-12H2.
What are the key properties of 2-(3,4-dihydro-1H-isoquinolin-2-yl)-4-phenyl-1,3-thiazole?
2-(3,4-dihydro-1H-isoquinolin-2-yl)-4-phenyl-1,3-thiazole has a molecular weight of 292.41 g/mol, XLogP of 4.37, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dihydro-1H-isoquinolin-2-yl)-4-phenyl-1,3-thiazole is sourced from PubChem (CID 686187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).