C43H37Cl2N13O3 — CID 68618904
1,2-bis[6-[(5-chloro-4-pyrazolo[1,5-a]pyridin-3-ylpyrimidin-2-yl)amino]-5-methoxy-2,3-dihydroindol-1-yl]-2-(methylamino)ethanone (PubChem CID 68618904) has the molecular formula C43H37Cl2N13O3 and a molecular weight of 854.76 g/mol. Its IUPAC name is 1,2-bis[6-[(5-chloro-4-pyrazolo[1,5-a]pyridin-3-ylpyrimidin-2-yl)amino]-5-methoxy-2,3-dihydroindol-1-yl]-2-(methylamino)ethanone.
| Compound Name | 1,2-bis[6-[(5-chloro-4-pyrazolo[1,5-a]pyridin-3-ylpyrimidin-2-yl)amino]-5-methoxy-2,3-dihydroindol-1-yl]-2-(methylamino)ethanone |
|---|---|
| PubChem CID | 68618904 |
| Molecular Formula | C43H37Cl2N13O3 |
| Molecular Weight | 854.76 g/mol |
| Exact Mass | 853.25 |
| IUPAC Name | 1,2-bis[6-[(5-chloro-4-pyrazolo[1,5-a]pyridin-3-ylpyrimidin-2-yl)amino]-5-methoxy-2,3-dihydroindol-1-yl]-2-(methylamino)ethanone |
| SMILES | CNC(C(=O)N1CCc2cc(OC)c(Nc3ncc(Cl)c(-c4cnn5ccccc45)n3)cc21)N1CCc2cc(OC)c(Nc3ncc(Cl)c(-c4cnn5ccccc45)n3)cc21 |
| InChI | InChI=1S/C43H37Cl2N13O3/c1-46-40(55-14-10-24-16-36(60-2)30(18-34(24)55)51-42-47-22-28(44)38(53-42)26-20-49-57-12-6-4-8-32(26)57)41(59)56-15-11-25-17-37(61-3)31(19-35(25)56)52-43-48-23-29(45)39(54-43)27-21-50-58-13-7-5-9-33(27)58/h4-9,12-13,16-23,40,46H,10-11,14-15H2,1-3H3,(H,47,51,53)(H,48,52,54) |
| InChIKey | YSHCPCWROVTNQV-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 164.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 854.76 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|