About [8-(3-chlorophenyl)imidazo[1,2-a]pyridin-6-yl]methyl hydrogen carbonate
[8-(3-chlorophenyl)imidazo[1,2-a]pyridin-6-yl]methyl hydrogen carbonate (PubChem CID 68619199) has the molecular formula C15H11ClN2O3
and a molecular weight of 302.72 g/mol. Its IUPAC name is [8-(3-chlorophenyl)imidazo[1,2-a]pyridin-6-yl]methyl hydrogen carbonate.
Molecular Properties
| Compound Name | [8-(3-chlorophenyl)imidazo[1,2-a]pyridin-6-yl]methyl hydrogen carbonate |
| PubChem CID | 68619199 |
| Molecular Formula | C15H11ClN2O3 |
| Molecular Weight | 302.72 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | [8-(3-chlorophenyl)imidazo[1,2-a]pyridin-6-yl]methyl hydrogen carbonate |
| SMILES | O=C(O)OCc1cc(-c2cccc(Cl)c2)c2nccn2c1 |
| InChI | InChI=1S/C15H11ClN2O3/c16-12-3-1-2-11(7-12)13-6-10(9-21-15(19)20)8-18-5-4-17-14(13)18/h1-8H,9H2,(H,19,20) |
| InChIKey | AEQYUHGVGXPOTA-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.72 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [8-(3-chlorophenyl)imidazo[1,2-a]pyridin-6-yl]methyl hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [8-(3-chlorophenyl)imidazo[1,2-a]pyridin-6-yl]methyl hydrogen carbonate?
The IUPAC name of [8-(3-chlorophenyl)imidazo[1,2-a]pyridin-6-yl]methyl hydrogen carbonate (CID 68619199) is [8-(3-chlorophenyl)imidazo[1,2-a]pyridin-6-yl]methyl hydrogen carbonate.
What is the SMILES notation for [8-(3-chlorophenyl)imidazo[1,2-a]pyridin-6-yl]methyl hydrogen carbonate?
The canonical SMILES for [8-(3-chlorophenyl)imidazo[1,2-a]pyridin-6-yl]methyl hydrogen carbonate is O=C(O)OCc1cc(-c2cccc(Cl)c2)c2nccn2c1.
What is the InChIKey of [8-(3-chlorophenyl)imidazo[1,2-a]pyridin-6-yl]methyl hydrogen carbonate?
The InChIKey is AEQYUHGVGXPOTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11ClN2O3/c16-12-3-1-2-11(7-12)13-6-10(9-21-15(19)20)8-18-5-4-17-14(13)18/h1-8H,9H2,(H,19,20).
What are the key properties of [8-(3-chlorophenyl)imidazo[1,2-a]pyridin-6-yl]methyl hydrogen carbonate?
[8-(3-chlorophenyl)imidazo[1,2-a]pyridin-6-yl]methyl hydrogen carbonate has a molecular weight of 302.72 g/mol, XLogP of 3.85, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [8-(3-chlorophenyl)imidazo[1,2-a]pyridin-6-yl]methyl hydrogen carbonate is sourced from PubChem (CID 68619199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).