C20H20ClN3O3 — CID 68619248
(5-methylpyrazin-2-yl) N-[(1S,3S)-3-[2-(3-chlorophenyl)ethynyl]-3-hydroxycyclohexyl]carbamate (PubChem CID 68619248) has the molecular formula C20H20ClN3O3 and a molecular weight of 385.85 g/mol. Its IUPAC name is (5-methylpyrazin-2-yl) N-[(1S,3S)-3-[2-(3-chlorophenyl)ethynyl]-3-hydroxycyclohexyl]carbamate.
| Compound Name | (5-methylpyrazin-2-yl) N-[(1S,3S)-3-[2-(3-chlorophenyl)ethynyl]-3-hydroxycyclohexyl]carbamate |
|---|---|
| PubChem CID | 68619248 |
| Molecular Formula | C20H20ClN3O3 |
| Molecular Weight | 385.85 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | (5-methylpyrazin-2-yl) N-[(1S,3S)-3-[2-(3-chlorophenyl)ethynyl]-3-hydroxycyclohexyl]carbamate |
| SMILES | Cc1cnc(OC(=O)N[C@H]2CCC[C@@](O)(C#Cc3cccc(Cl)c3)C2)cn1 |
| InChI | InChI=1S/C20H20ClN3O3/c1-14-12-23-18(13-22-14)27-19(25)24-17-6-3-8-20(26,11-17)9-7-15-4-2-5-16(21)10-15/h2,4-5,10,12-13,17,26H,3,6,8,11H2,1H3,(H,24,25)/t17-,20+/m0/s1 |
| InChIKey | STVKGIRFPLUHOK-FXAWDEMLSA-N |
| XLogP | 3.25 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.85 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|