C6H13N9O3 — CID 68619363
2,4-dihydrotriazine-1,3,5-tricarbohydrazide (PubChem CID 68619363) has the molecular formula C6H13N9O3 and a molecular weight of 259.23 g/mol. Its IUPAC name is 2,4-dihydrotriazine-1,3,5-tricarbohydrazide.
| Compound Name | 2,4-dihydrotriazine-1,3,5-tricarbohydrazide |
|---|---|
| PubChem CID | 68619363 |
| Molecular Formula | C6H13N9O3 |
| Molecular Weight | 259.23 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 2,4-dihydrotriazine-1,3,5-tricarbohydrazide |
| SMILES | NNC(=O)C1=CN(C(=O)NN)NN(C(=O)NN)C1 |
| InChI | InChI=1S/C6H13N9O3/c7-10-4(16)3-1-14(5(17)11-8)13-15(2-3)6(18)12-9/h1,13H,2,7-9H2,(H,10,16)(H,11,17)(H,12,18) |
| InChIKey | GYILXHNBRBFJSV-UHFFFAOYSA-N |
| XLogP | -3.94 |
| TPSA | 183.87 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.23 |
| LogP ≤ 5 | -3.94 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|