C31H33FN4O5 — CID 68619801
(2S,3S)-N-[4-(azetidin-1-yl)-2-fluorophenyl]-2-[(4R)-4-[4-(2-methoxyethoxy)phenyl]-2,5-dioxoimidazolidin-1-yl]-3-phenylbutanamide (PubChem CID 68619801) has the molecular formula C31H33FN4O5 and a molecular weight of 560.63 g/mol. Its IUPAC name is (2S,3S)-N-[4-(azetidin-1-yl)-2-fluorophenyl]-2-[(4R)-4-[4-(2-methoxyethoxy)phenyl]-2,5-dioxoimidazolidin-1-yl]-3-phenylbutanamide.
| Compound Name | (2S,3S)-N-[4-(azetidin-1-yl)-2-fluorophenyl]-2-[(4R)-4-[4-(2-methoxyethoxy)phenyl]-2,5-dioxoimidazolidin-1-yl]-3-phenylbutanamide |
|---|---|
| PubChem CID | 68619801 |
| Molecular Formula | C31H33FN4O5 |
| Molecular Weight | 560.63 g/mol |
| Exact Mass | 560.24 |
| IUPAC Name | (2S,3S)-N-[4-(azetidin-1-yl)-2-fluorophenyl]-2-[(4R)-4-[4-(2-methoxyethoxy)phenyl]-2,5-dioxoimidazolidin-1-yl]-3-phenylbutanamide |
| SMILES | COCCOc1ccc([C@H]2NC(=O)N([C@H](C(=O)Nc3ccc(N4CCC4)cc3F)[C@@H](C)c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C31H33FN4O5/c1-20(21-7-4-3-5-8-21)28(29(37)33-26-14-11-23(19-25(26)32)35-15-6-16-35)36-30(38)27(34-31(36)39)22-9-12-24(13-10-22)41-18-17-40-2/h3-5,7-14,19-20,27-28H,6,15-18H2,1-2H3,(H,33,37)(H,34,39)/t20-,27+,28-/m0/s1 |
| InChIKey | HFOCSIHWHRZCPY-UASRBLEQSA-N |
| XLogP | 4.46 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.63 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|