C16H34N2O3 — CID 68620020
1-butylpiperidine;2,3-dimethylpiperidine-3,4,5-triol (PubChem CID 68620020) has the molecular formula C16H34N2O3 and a molecular weight of 302.46 g/mol. Its IUPAC name is 1-butylpiperidine;2,3-dimethylpiperidine-3,4,5-triol.
| Compound Name | 1-butylpiperidine;2,3-dimethylpiperidine-3,4,5-triol |
|---|---|
| PubChem CID | 68620020 |
| Molecular Formula | C16H34N2O3 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.26 |
| IUPAC Name | 1-butylpiperidine;2,3-dimethylpiperidine-3,4,5-triol |
| SMILES | CC1NCC(O)C(O)C1(C)O.CCCCN1CCCCC1 |
| InChI | InChI=1S/C9H19N.C7H15NO3/c1-2-3-7-10-8-5-4-6-9-10;1-4-7(2,11)6(10)5(9)3-8-4/h2-9H2,1H3;4-6,8-11H,3H2,1-2H3 |
| InChIKey | AKDIXYGKFIEJHJ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |