C9H10N2O2 — CID 68620164
4,4-dimethyl-1H-pyrido[2,3-d][1,3]oxazin-2-one (PubChem CID 68620164) has the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. Its IUPAC name is 4,4-dimethyl-1H-pyrido[2,3-d][1,3]oxazin-2-one.
| Compound Name | 4,4-dimethyl-1H-pyrido[2,3-d][1,3]oxazin-2-one |
|---|---|
| PubChem CID | 68620164 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | 4,4-dimethyl-1H-pyrido[2,3-d][1,3]oxazin-2-one |
| SMILES | CC1(C)OC(=O)Nc2ncccc21 |
| InChI | InChI=1S/C9H10N2O2/c1-9(2)6-4-3-5-10-7(6)11-8(12)13-9/h3-5H,1-2H3,(H,10,11,12) |
| InChIKey | YKJUGFJWVDMTFQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |