C24H22ClN5O3 — CID 68620170
8-chloro-1-[4-(4-cyanophenoxy)cyclohexyl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine-5-carboxylic acid (PubChem CID 68620170) has the molecular formula C24H22ClN5O3 and a molecular weight of 463.93 g/mol. Its IUPAC name is 8-chloro-1-[4-(4-cyanophenoxy)cyclohexyl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine-5-carboxylic acid.
| Compound Name | 8-chloro-1-[4-(4-cyanophenoxy)cyclohexyl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine-5-carboxylic acid |
|---|---|
| PubChem CID | 68620170 |
| Molecular Formula | C24H22ClN5O3 |
| Molecular Weight | 463.93 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | 8-chloro-1-[4-(4-cyanophenoxy)cyclohexyl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine-5-carboxylic acid |
| SMILES | N#Cc1ccc(OC2CCC(c3nnc4n3-c3ccc(Cl)cc3CN(C(=O)O)C4)CC2)cc1 |
| InChI | InChI=1S/C24H22ClN5O3/c25-18-5-10-21-17(11-18)13-29(24(31)32)14-22-27-28-23(30(21)22)16-3-8-20(9-4-16)33-19-6-1-15(12-26)2-7-19/h1-2,5-7,10-11,16,20H,3-4,8-9,13-14H2,(H,31,32) |
| InChIKey | UGQCCNOWGBBYLI-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 104.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.93 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |