C31H32FN3O6 — CID 68620200
(2S,3S)-N-(4-cyclopropyl-2-fluorophenyl)-2-[4-[4-(2,3-dihydroxypropoxy)phenyl]-2,5-dioxoimidazolidin-1-yl]-3-phenylbutanamide (PubChem CID 68620200) has the molecular formula C31H32FN3O6 and a molecular weight of 561.61 g/mol. Its IUPAC name is (2S,3S)-N-(4-cyclopropyl-2-fluorophenyl)-2-[4-[4-(2,3-dihydroxypropoxy)phenyl]-2,5-dioxoimidazolidin-1-yl]-3-phenylbutanamide.
| Compound Name | (2S,3S)-N-(4-cyclopropyl-2-fluorophenyl)-2-[4-[4-(2,3-dihydroxypropoxy)phenyl]-2,5-dioxoimidazolidin-1-yl]-3-phenylbutanamide |
|---|---|
| PubChem CID | 68620200 |
| Molecular Formula | C31H32FN3O6 |
| Molecular Weight | 561.61 g/mol |
| Exact Mass | 561.23 |
| IUPAC Name | (2S,3S)-N-(4-cyclopropyl-2-fluorophenyl)-2-[4-[4-(2,3-dihydroxypropoxy)phenyl]-2,5-dioxoimidazolidin-1-yl]-3-phenylbutanamide |
| SMILES | C[C@@H](c1ccccc1)[C@@H](C(=O)Nc1ccc(C2CC2)cc1F)N1C(=O)NC(c2ccc(OCC(O)CO)cc2)C1=O |
| InChI | InChI=1S/C31H32FN3O6/c1-18(19-5-3-2-4-6-19)28(29(38)33-26-14-11-22(15-25(26)32)20-7-8-20)35-30(39)27(34-31(35)40)21-9-12-24(13-10-21)41-17-23(37)16-36/h2-6,9-15,18,20,23,27-28,36-37H,7-8,16-17H2,1H3,(H,33,38)(H,34,40)/t18-,23?,27?,28-/m0/s1 |
| InChIKey | FRQJOYSEAJBJQJ-UHIQNCMFSA-N |
| XLogP | 3.84 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.61 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|