About 5-(cyclohexylmethyl)-7,8-dihydropyrazino[2,3-b]pyrazin-6-one
5-(cyclohexylmethyl)-7,8-dihydropyrazino[2,3-b]pyrazin-6-one (PubChem CID 68620302) has the molecular formula C13H18N4O
and a molecular weight of 246.31 g/mol. Its IUPAC name is 5-(cyclohexylmethyl)-7,8-dihydropyrazino[2,3-b]pyrazin-6-one.
Molecular Properties
| Compound Name | 5-(cyclohexylmethyl)-7,8-dihydropyrazino[2,3-b]pyrazin-6-one |
| PubChem CID | 68620302 |
| Molecular Formula | C13H18N4O |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 5-(cyclohexylmethyl)-7,8-dihydropyrazino[2,3-b]pyrazin-6-one |
| SMILES | O=C1CNc2nccnc2N1CC1CCCCC1 |
| InChI | InChI=1S/C13H18N4O/c18-11-8-16-12-13(15-7-6-14-12)17(11)9-10-4-2-1-3-5-10/h6-7,10H,1-5,8-9H2,(H,14,16) |
| InChIKey | BBEUSLPTFUUEPV-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(cyclohexylmethyl)-7,8-dihydropyrazino[2,3-b]pyrazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(cyclohexylmethyl)-7,8-dihydropyrazino[2,3-b]pyrazin-6-one?
The IUPAC name of 5-(cyclohexylmethyl)-7,8-dihydropyrazino[2,3-b]pyrazin-6-one (CID 68620302) is 5-(cyclohexylmethyl)-7,8-dihydropyrazino[2,3-b]pyrazin-6-one.
What is the SMILES notation for 5-(cyclohexylmethyl)-7,8-dihydropyrazino[2,3-b]pyrazin-6-one?
The canonical SMILES for 5-(cyclohexylmethyl)-7,8-dihydropyrazino[2,3-b]pyrazin-6-one is O=C1CNc2nccnc2N1CC1CCCCC1.
What is the InChIKey of 5-(cyclohexylmethyl)-7,8-dihydropyrazino[2,3-b]pyrazin-6-one?
The InChIKey is BBEUSLPTFUUEPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N4O/c18-11-8-16-12-13(15-7-6-14-12)17(11)9-10-4-2-1-3-5-10/h6-7,10H,1-5,8-9H2,(H,14,16).
What are the key properties of 5-(cyclohexylmethyl)-7,8-dihydropyrazino[2,3-b]pyrazin-6-one?
5-(cyclohexylmethyl)-7,8-dihydropyrazino[2,3-b]pyrazin-6-one has a molecular weight of 246.31 g/mol, XLogP of 1.82, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(cyclohexylmethyl)-7,8-dihydropyrazino[2,3-b]pyrazin-6-one is sourced from PubChem (CID 68620302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).