C21H34N2O5 — CID 68620433
(2S)-2-[[(2R)-2-amino-2-[4-[2-[(2-methylpropan-2-yl)oxy]ethoxy]phenyl]acetyl]amino]-4,4-dimethylpentanoic acid (PubChem CID 68620433) has the molecular formula C21H34N2O5 and a molecular weight of 394.51 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2-amino-2-[4-[2-[(2-methylpropan-2-yl)oxy]ethoxy]phenyl]acetyl]amino]-4,4-dimethylpentanoic acid.
| Compound Name | (2S)-2-[[(2R)-2-amino-2-[4-[2-[(2-methylpropan-2-yl)oxy]ethoxy]phenyl]acetyl]amino]-4,4-dimethylpentanoic acid |
|---|---|
| PubChem CID | 68620433 |
| Molecular Formula | C21H34N2O5 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | (2S)-2-[[(2R)-2-amino-2-[4-[2-[(2-methylpropan-2-yl)oxy]ethoxy]phenyl]acetyl]amino]-4,4-dimethylpentanoic acid |
| SMILES | CC(C)(C)C[C@H](NC(=O)[C@H](N)c1ccc(OCCOC(C)(C)C)cc1)C(=O)O |
| InChI | InChI=1S/C21H34N2O5/c1-20(2,3)13-16(19(25)26)23-18(24)17(22)14-7-9-15(10-8-14)27-11-12-28-21(4,5)6/h7-10,16-17H,11-13,22H2,1-6H3,(H,23,24)(H,25,26)/t16-,17+/m0/s1 |
| InChIKey | PBOQTGFWNRUWNI-DLBZAZTESA-N |
| XLogP | 2.89 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|