C15H28N2O5 — CID 68621158
N-[[(3aR,4S,6aS)-5-[2-(2-methoxyethoxy)ethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]methyl]acetamide (PubChem CID 68621158) has the molecular formula C15H28N2O5 and a molecular weight of 316.40 g/mol. Its IUPAC name is N-[[(3aR,4S,6aS)-5-[2-(2-methoxyethoxy)ethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]methyl]acetamide.
| Compound Name | N-[[(3aR,4S,6aS)-5-[2-(2-methoxyethoxy)ethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]methyl]acetamide |
|---|---|
| PubChem CID | 68621158 |
| Molecular Formula | C15H28N2O5 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | N-[[(3aR,4S,6aS)-5-[2-(2-methoxyethoxy)ethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]methyl]acetamide |
| SMILES | COCCOCCN1C[C@@H]2OC(C)(C)O[C@@H]2[C@@H]1CNC(C)=O |
| InChI | InChI=1S/C15H28N2O5/c1-11(18)16-9-12-14-13(21-15(2,3)22-14)10-17(12)5-6-20-8-7-19-4/h12-14H,5-10H2,1-4H3,(H,16,18)/t12-,13-,14+/m0/s1 |
| InChIKey | STRXKCPXPNJXCK-MELADBBJSA-N |
| XLogP | -0.01 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|