About 4-bromo-1-[2-(2-fluorophenyl)-1,8-naphthyridin-4-yl]-2,6-naphthyridine
4-bromo-1-[2-(2-fluorophenyl)-1,8-naphthyridin-4-yl]-2,6-naphthyridine (PubChem CID 68621298) has the molecular formula C22H12BrFN4
and a molecular weight of 431.27 g/mol. Its IUPAC name is 4-bromo-1-[2-(2-fluorophenyl)-1,8-naphthyridin-4-yl]-2,6-naphthyridine.
Molecular Properties
| Compound Name | 4-bromo-1-[2-(2-fluorophenyl)-1,8-naphthyridin-4-yl]-2,6-naphthyridine |
| PubChem CID | 68621298 |
| Molecular Formula | C22H12BrFN4 |
| Molecular Weight | 431.27 g/mol |
| Exact Mass | 430.02 |
| IUPAC Name | 4-bromo-1-[2-(2-fluorophenyl)-1,8-naphthyridin-4-yl]-2,6-naphthyridine |
| SMILES | Fc1ccccc1-c1cc(-c2ncc(Br)c3cnccc23)c2cccnc2n1 |
| InChI | InChI=1S/C22H12BrFN4/c23-18-12-27-21(13-7-9-25-11-17(13)18)16-10-20(15-4-1-2-6-19(15)24)28-22-14(16)5-3-8-26-22/h1-12H |
| InChIKey | YZHDOPPRJNNWRI-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 431.27 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-bromo-1-[2-(2-fluorophenyl)-1,8-naphthyridin-4-yl]-2,6-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-1-[2-(2-fluorophenyl)-1,8-naphthyridin-4-yl]-2,6-naphthyridine?
The IUPAC name of 4-bromo-1-[2-(2-fluorophenyl)-1,8-naphthyridin-4-yl]-2,6-naphthyridine (CID 68621298) is 4-bromo-1-[2-(2-fluorophenyl)-1,8-naphthyridin-4-yl]-2,6-naphthyridine.
What is the SMILES notation for 4-bromo-1-[2-(2-fluorophenyl)-1,8-naphthyridin-4-yl]-2,6-naphthyridine?
The canonical SMILES for 4-bromo-1-[2-(2-fluorophenyl)-1,8-naphthyridin-4-yl]-2,6-naphthyridine is Fc1ccccc1-c1cc(-c2ncc(Br)c3cnccc23)c2cccnc2n1.
What is the InChIKey of 4-bromo-1-[2-(2-fluorophenyl)-1,8-naphthyridin-4-yl]-2,6-naphthyridine?
The InChIKey is YZHDOPPRJNNWRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H12BrFN4/c23-18-12-27-21(13-7-9-25-11-17(13)18)16-10-20(15-4-1-2-6-19(15)24)28-22-14(16)5-3-8-26-22/h1-12H.
What are the key properties of 4-bromo-1-[2-(2-fluorophenyl)-1,8-naphthyridin-4-yl]-2,6-naphthyridine?
4-bromo-1-[2-(2-fluorophenyl)-1,8-naphthyridin-4-yl]-2,6-naphthyridine has a molecular weight of 431.27 g/mol, XLogP of 5.81, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-1-[2-(2-fluorophenyl)-1,8-naphthyridin-4-yl]-2,6-naphthyridine is sourced from PubChem (CID 68621298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).