C9H8BrN3S2 — CID 686214
6-(4-bromophenyl)-1,3,5-triazinane-2,4-dithione (PubChem CID 686214) has the molecular formula C9H8BrN3S2 and a molecular weight of 302.22 g/mol. Its IUPAC name is 6-(4-bromophenyl)-1,3,5-triazinane-2,4-dithione.
| Compound Name | 6-(4-bromophenyl)-1,3,5-triazinane-2,4-dithione |
|---|---|
| PubChem CID | 686214 |
| Molecular Formula | C9H8BrN3S2 |
| Molecular Weight | 302.22 g/mol |
| Exact Mass | 300.93 |
| IUPAC Name | 6-(4-bromophenyl)-1,3,5-triazinane-2,4-dithione |
| SMILES | S=C1NC(=S)NC(c2ccc(Br)cc2)N1 |
| InChI | InChI=1S/C9H8BrN3S2/c10-6-3-1-5(2-4-6)7-11-8(14)13-9(15)12-7/h1-4,7H,(H3,11,12,13,14,15) |
| InChIKey | DVTVSCYTPHXNCW-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.22 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|