C5H9NO3 — CID 68621538
2,3,4,5-tetrahydropyridine-3,4,5-triol (PubChem CID 68621538) has the molecular formula C5H9NO3 and a molecular weight of 131.13 g/mol. Its IUPAC name is 2,3,4,5-tetrahydropyridine-3,4,5-triol.
| Compound Name | 2,3,4,5-tetrahydropyridine-3,4,5-triol |
|---|---|
| PubChem CID | 68621538 |
| Molecular Formula | C5H9NO3 |
| Molecular Weight | 131.13 g/mol |
| Exact Mass | 131.06 |
| IUPAC Name | 2,3,4,5-tetrahydropyridine-3,4,5-triol |
| SMILES | OC1C=NCC(O)C1O |
| InChI | InChI=1S/C5H9NO3/c7-3-1-6-2-4(8)5(3)9/h1,3-5,7-9H,2H2 |
| InChIKey | HHAUJQNCRMPWRN-UHFFFAOYSA-N |
| XLogP | -1.85 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.13 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |