About 2,3-dihydro-1H-pyrano[3,2-d]pyrimidine
2,3-dihydro-1H-pyrano[3,2-d]pyrimidine (PubChem CID 68622143) has the molecular formula C7H8N2O
and a molecular weight of 136.15 g/mol. Its IUPAC name is 2,3-dihydro-1H-pyrano[3,2-d]pyrimidine.
Molecular Properties
| Compound Name | 2,3-dihydro-1H-pyrano[3,2-d]pyrimidine |
| PubChem CID | 68622143 |
| Molecular Formula | C7H8N2O |
| Molecular Weight | 136.15 g/mol |
| Exact Mass | 136.06 |
| IUPAC Name | 2,3-dihydro-1H-pyrano[3,2-d]pyrimidine |
| SMILES | C1=COC2=CNCNC2=C1 |
| InChI | InChI=1S/C7H8N2O/c1-2-6-7(10-3-1)4-8-5-9-6/h1-4,8-9H,5H2 |
| InChIKey | GPLHOBGGFNJIGJ-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.15 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,3-dihydro-1H-pyrano[3,2-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-1H-pyrano[3,2-d]pyrimidine?
The IUPAC name of 2,3-dihydro-1H-pyrano[3,2-d]pyrimidine (CID 68622143) is 2,3-dihydro-1H-pyrano[3,2-d]pyrimidine.
What is the SMILES notation for 2,3-dihydro-1H-pyrano[3,2-d]pyrimidine?
The canonical SMILES for 2,3-dihydro-1H-pyrano[3,2-d]pyrimidine is C1=COC2=CNCNC2=C1.
What is the InChIKey of 2,3-dihydro-1H-pyrano[3,2-d]pyrimidine?
The InChIKey is GPLHOBGGFNJIGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O/c1-2-6-7(10-3-1)4-8-5-9-6/h1-4,8-9H,5H2.
What are the key properties of 2,3-dihydro-1H-pyrano[3,2-d]pyrimidine?
2,3-dihydro-1H-pyrano[3,2-d]pyrimidine has a molecular weight of 136.15 g/mol, XLogP of 0.41, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1H-pyrano[3,2-d]pyrimidine is sourced from PubChem (CID 68622143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).