C7H14O4 — CID 68622312
formaldehyde;2,4,6-trimethyl-1,3,5-trioxane (PubChem CID 68622312) has the molecular formula C7H14O4 and a molecular weight of 162.18 g/mol. Its IUPAC name is formaldehyde;2,4,6-trimethyl-1,3,5-trioxane.
| Compound Name | formaldehyde;2,4,6-trimethyl-1,3,5-trioxane |
|---|---|
| PubChem CID | 68622312 |
| Molecular Formula | C7H14O4 |
| Molecular Weight | 162.18 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | formaldehyde;2,4,6-trimethyl-1,3,5-trioxane |
| SMILES | C=O.CC1OC(C)OC(C)O1 |
| InChI | InChI=1S/C6H12O3.CH2O/c1-4-7-5(2)9-6(3)8-4;1-2/h4-6H,1-3H3;1H2 |
| InChIKey | DSPHXJOPRKTKHS-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.18 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |