C12H13F2NO3 — CID 68622399
4-(2,4-difluorophenyl)-4-hydroxypiperidine-1-carboxylic acid (PubChem CID 68622399) has the molecular formula C12H13F2NO3 and a molecular weight of 257.24 g/mol. Its IUPAC name is 4-(2,4-difluorophenyl)-4-hydroxypiperidine-1-carboxylic acid.
| Compound Name | 4-(2,4-difluorophenyl)-4-hydroxypiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 68622399 |
| Molecular Formula | C12H13F2NO3 |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 4-(2,4-difluorophenyl)-4-hydroxypiperidine-1-carboxylic acid |
| SMILES | O=C(O)N1CCC(O)(c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C12H13F2NO3/c13-8-1-2-9(10(14)7-8)12(18)3-5-15(6-4-12)11(16)17/h1-2,7,18H,3-6H2,(H,16,17) |
| InChIKey | HOQZIEZBXLYXFE-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |