C28H45F2N3O6 — CID 68622577
N-[(2S,4S,5S)-4-amino-6-[[2,2-difluoro-2-(oxan-4-yl)acetyl]amino]-5-hydroxy-2-propan-2-ylhexyl]-2-(4-methoxybutoxy)benzamide (PubChem CID 68622577) has the molecular formula C28H45F2N3O6 and a molecular weight of 557.68 g/mol. Its IUPAC name is N-[(2S,4S,5S)-4-amino-6-[[2,2-difluoro-2-(oxan-4-yl)acetyl]amino]-5-hydroxy-2-propan-2-ylhexyl]-2-(4-methoxybutoxy)benzamide.
| Compound Name | N-[(2S,4S,5S)-4-amino-6-[[2,2-difluoro-2-(oxan-4-yl)acetyl]amino]-5-hydroxy-2-propan-2-ylhexyl]-2-(4-methoxybutoxy)benzamide |
|---|---|
| PubChem CID | 68622577 |
| Molecular Formula | C28H45F2N3O6 |
| Molecular Weight | 557.68 g/mol |
| Exact Mass | 557.33 |
| IUPAC Name | N-[(2S,4S,5S)-4-amino-6-[[2,2-difluoro-2-(oxan-4-yl)acetyl]amino]-5-hydroxy-2-propan-2-ylhexyl]-2-(4-methoxybutoxy)benzamide |
| SMILES | COCCCCOc1ccccc1C(=O)NC[C@@H](C[C@H](N)[C@@H](O)CNC(=O)C(F)(F)C1CCOCC1)C(C)C |
| InChI | InChI=1S/C28H45F2N3O6/c1-19(2)20(17-32-26(35)22-8-4-5-9-25(22)39-13-7-6-12-37-3)16-23(31)24(34)18-33-27(36)28(29,30)21-10-14-38-15-11-21/h4-5,8-9,19-21,23-24,34H,6-7,10-18,31H2,1-3H3,(H,32,35)(H,33,36)/t20-,23+,24+/m1/s1 |
| InChIKey | UBGQHZSLSHHKAP-QDSKXPNFSA-N |
| XLogP | 2.75 |
| TPSA | 132.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.68 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|