C12H21ClN2 — CID 68622660
4-N,4-N,2-triethylbenzene-1,4-diamine;hydrochloride (PubChem CID 68622660) has the molecular formula C12H21ClN2 and a molecular weight of 228.77 g/mol. Its IUPAC name is 4-N,4-N,2-triethylbenzene-1,4-diamine;hydrochloride.
| Compound Name | 4-N,4-N,2-triethylbenzene-1,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 68622660 |
| Molecular Formula | C12H21ClN2 |
| Molecular Weight | 228.77 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 4-N,4-N,2-triethylbenzene-1,4-diamine;hydrochloride |
| SMILES | CCc1cc(N(CC)CC)ccc1N.Cl |
| InChI | InChI=1S/C12H20N2.ClH/c1-4-10-9-11(7-8-12(10)13)14(5-2)6-3;/h7-9H,4-6,13H2,1-3H3;1H |
| InChIKey | LDMQZKHQPCIQSU-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.77 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|